phenyl 2-methyl-5-nitrobenzenesulphonate structure
|
Common Name | phenyl 2-methyl-5-nitrobenzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 85896-03-3 | Molecular Weight | 293.29500 | |
| Density | 1.388g/cm3 | Boiling Point | 473.3ºC at 760mmHg | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240ºC | |
| Name | phenyl 2-methyl-5-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 473.3ºC at 760mmHg |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.29500 |
| Flash Point | 240ºC |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.27490 |
| Index of Refraction | 1.604 |
| InChIKey | DUEHZNNBLUTVHR-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Oc1ccccc1 |
| HS Code | 2906299090 |
|---|
|
~%
phenyl 2-methyl... CAS#:85896-03-3 |
| Literature: Green; Marsden; Scholefield Journal of the Chemical Society, 1904 , vol. 85, p. 1436 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 288-780-0 |
| 4-Nitro-toluol-2-sulfonsaeure-phenylester |
| Phenyl4-nitrotoluene-2-sulfonate |
| 4-nitro-toluene-2-sulfonic acid phenyl ester |