2-Methyl-5-nitrobenzenesulfonyl chloride structure
|
Common Name | 2-Methyl-5-nitrobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 121-02-8 | Molecular Weight | 235.64500 | |
| Density | 1.528 g/cm3 | Boiling Point | 135-137°C/0.7mm | |
| Molecular Formula | C7H6ClNO4S | Melting Point | 43 °C | |
| MSDS | Chinese USA | Flash Point | 135-137°C/0.7mm | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-Methyl-5-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528 g/cm3 |
|---|---|
| Boiling Point | 135-137°C/0.7mm |
| Melting Point | 43 °C |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | 135-137°C/0.7mm |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.43470 |
| Vapour Pressure | 2.57E-05mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | WPGVQDHXOUAJBW-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R14;R29;R34 |
| Safety Phrases | S22-S26-S30-S45-S8-S36/37/39 |
| RIDADR | 3261 |
| RTECS | XT8000000 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~98%
2-Methyl-5-nitr... CAS#:121-02-8 |
| Literature: Tagiev; Kazaz; Anyl Russian Journal of Applied Chemistry, 2012 , vol. 85, # 10 p. 1581 - 1585 Zh. Prikl. Khim. (S.-Peterburg, Russ. Fed.), 2012 , vol. 85, # 10 p. 1648 - 1652,5 |
|
~%
2-Methyl-5-nitr... CAS#:121-02-8 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 117, p. 21 |
| Precursor 4 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 204-444-8 |
| 2-Methyl-5-Nitrobenzene-1-Sulfonyl Chloride |
| 5-Nitro-o-toluenesulfonyl Chloride |
| 4-nitrotoluene-2-sulfochloride |
| Benzenesulfonyl chloride,2-methyl-5-nitro |
| 2-Methyl-5-nitrobenzenesulfonylchloride |
| 5-nitro-2-methyl-phenylsulfonyl chloride |
| MFCD00051695 |
| 4-Nitrotoluene-2-sulphonyl chloride |
| 2-Methyl-5-nitrobenzenesulfonyl Chloride |
| 2-methyl-5-nitro-benzene-sulfonyl chloride |
| 4-Nitrotoluen-2-sulfochlorid |
| 2-methyl-5-nitro-benzenesulphonyl chloride |
| o-Toluenesulfonyl chloride,5-nitro |
| sulfonyl chloride |
| 5-nitro-2-methylbenzenesulfonylchloride |