2-Chloro-N,N-diethyl-4-nitroaniline structure
|
Common Name | 2-Chloro-N,N-diethyl-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 86-49-7 | Molecular Weight | 228.67500 | |
| Density | 1.241g/cm3 | Boiling Point | 326.7ºC at 760 mmHg | |
| Molecular Formula | C10H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | 2-Chloro-N,N-diethyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 326.7ºC at 760 mmHg |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.67500 |
| Flash Point | 151.4ºC |
| Exact Mass | 228.06700 |
| PSA | 49.06000 |
| LogP | 3.61760 |
| Index of Refraction | 1.579 |
| InChIKey | PCVJAZCSKCCKPQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1Cl |
|
~91%
2-Chloro-N,N-di... CAS#:86-49-7 |
| Literature: Ibata, Toshikazu; Isogami, Yasushi; Toyoda, Jiro Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 1 p. 42 - 49 |
|
~%
2-Chloro-N,N-di... CAS#:86-49-7 |
| Literature: Holleman; de Mooy Recueil des Travaux Chimiques des Pays-Bas, 1916 , vol. 35, p. 17,25 |
| Aniline,2-chloro-N,N-diethyl-4-nitro |
| EINECS 201-675-6 |
| N,N-Diaethyl-2-chlor-4-nitro-anilin |
| Benzenamine,2-chloro-N,N-diethyl-4-nitro |
| N,N-diethyl-2-chloro-4-nitro-aniline |