diethylaluminum,dimethyl(phenyl)silicon structure
|
Common Name | diethylaluminum,dimethyl(phenyl)silicon | ||
|---|---|---|---|---|
| CAS Number | 86014-18-8 | Molecular Weight | 220.36200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21AlSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethylaluminum,dimethyl(phenyl)silicon |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H21AlSi |
|---|---|
| Molecular Weight | 220.36200 |
| Exact Mass | 220.12300 |
| LogP | 3.32880 |
| InChIKey | VJCFOIBHDDYFAM-UHFFFAOYSA-N |
| SMILES | CC[Al]CC.C[Si](C)c1ccccc1 |
|
~%
diethylaluminum... CAS#:86014-18-8 |
| Literature: Fugami, Keigo; Oshima, Koichiro; Utimoto, Kiitiro; Nozaki, Hitosi Bulletin of the Chemical Society of Japan, 1987 , vol. 60, # 7 p. 2509 - 2516 |
| Aluminum,(dimethylphenylsilyl)diethyl |