6-Bromo-2,3-dimethyl-4-nitroaniline structure
|
Common Name | 6-Bromo-2,3-dimethyl-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 860570-23-6 | Molecular Weight | 245.073 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 376.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.6±26.5 °C | |
| Name | 6-bromo-2,3-dimethyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.7±37.0 °C at 760 mmHg |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.073 |
| Flash Point | 181.6±26.5 °C |
| Exact Mass | 243.984726 |
| PSA | 71.84000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | SACJHENIOITGGB-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc(Br)c(N)c1C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2921430090 |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Amino-5-bromo-2,3-dimethyl-1-nitrobenzene |
| Benzenamine, 6-bromo-2,3-dimethyl-4-nitro- |
| 6-Bromo-2,3-dimethyl-4-nitroaniline |