4-(2,3-dimethylhexan-2-yl)phenol structure
|
Common Name | 4-(2,3-dimethylhexan-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 861011-61-2 | Molecular Weight | 206.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,3-dimethylhexan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H22O |
|---|---|
| Molecular Weight | 206.32400 |
| Exact Mass | 206.16700 |
| PSA | 20.23000 |
| LogP | 4.10600 |
| InChIKey | RJMVWHDIOMDTHL-UHFFFAOYSA-N |
| SMILES | CCCC(C)C(C)(C)c1ccc(O)cc1 |
|
~%
4-(2,3-dimethyl... CAS#:861011-61-2 |
| Literature: Huston; Guile Journal of the American Chemical Society, 1939 , vol. 61, p. 69 |
|
~%
4-(2,3-dimethyl... CAS#:861011-61-2 |
| Literature: Huston; Guile Journal of the American Chemical Society, 1939 , vol. 61, p. 69 |
| Phenol,4-(1,1,2-trimethylpentyl) |
| 4-(1,1,2-Trimethyl-pentyl)-phenol |
| (+-)-4-Hydroxy-1-(1.1.2-trimethyl-pentyl)-benzol |