primisulfuron-methyl structure
|
Common Name | primisulfuron-methyl | ||
|---|---|---|---|---|
| CAS Number | 86209-51-0 | Molecular Weight | 468.33700 | |
| Density | 1.582g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H12F4N4O7S | Melting Point | 203.1ºC | |
| MSDS | Chinese USA | Flash Point | 203 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | primisulfuron-methyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.582g/cm3 |
|---|---|
| Melting Point | 203.1ºC |
| Molecular Formula | C15H12F4N4O7S |
| Molecular Weight | 468.33700 |
| Flash Point | 203 °C |
| Exact Mass | 468.03600 |
| PSA | 154.19000 |
| LogP | 3.52110 |
| Index of Refraction | 1.535 |
| InChIKey | ZTYVMAQSHCZXLF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(OC(F)F)cc(OC(F)F)n1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
Crosstalk and differential response to abiotic and biotic stressors reflected at the transcriptional level of effector genes from secondary metabolism.
Plant Mol. Biol. 54(6) , 817-35, (2004) Plant secondary metabolism significantly contributes to defensive measures against adverse abiotic and biotic cues. To investigate stress-induced, transcriptional alterations of underlying effector ge... |
|
|
Degradation of primisulfuron by a combination of chemical and microbiological processes.
J. Agric. Food Chem. 48(6) , 2565-71, (2000) Microbial degradation of the herbicide primisulfuron was investigated using enrichment cultures from contaminated soils and 20 axenic cultures. At neutral pH, no disappearance of the herbicide was det... |
|
|
AtOPT6 transports glutathione derivatives and is induced by primisulfuron.
Plant Physiol. 135(3) , 1378-87, (2004) The oligopeptide transporter (OPT) family contains nine members in Arabidopsis. While there is some evidence that AtOPTs mediate the uptake of tetra- and pentapeptides, OPT homologs in rice (Oryza sat... |
|
Name: qHTS assay for small molecule antagonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRN10
|
|
Name: qHTS assay for small molecule agonists of farnesoid X receptor signaling
Source: NCGC
Target: farnesoid X nuclear receptor [Homo sapiens]
External Id: FXRA10
|
|
Name: qHTS assay for small molecule agonists of the antioxidant response element (ARE) sign...
Source: NCGC
Target: N/A
External Id: ARE853
|
|
Name: qHTS assay for small molecule agonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRA10
|
|
Name: qHTS assay for small molecule agonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBA10
|
|
Name: qHTS assay for small molecule antagonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERN101
|
|
Name: qHTS assay for small molecule agonists of estrogen receptor alpha signaling
Source: NCGC
Target: estrogen nuclear receptor alpha [Homo sapiens]
External Id: ERA101
|
|
Name: qHTS assay for small molecule antagonists of retinoid X receptor alpha signaling
Source: NCGC
Target: retinoid X nuclear receptor alpha [Homo sapiens]
External Id: RXRN10
|
|
Name: qHTS assay for small molecule antagonists of thyroid hormone receptor beta signaling
Source: NCGC
Target: thyroid hormone receptor beta [Homo sapiens]
External Id: TRBN10
|
|
Name: qHTS assay for small molecule agonists of androgen receptor signaling
Source: NCGC
Target: AR protein [Homo sapiens]
External Id: ARA101
|
| methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfamoyl]benzoate |
| Primisulfuron-methyl |
| MFCD00337169 |
| methyl 2-[[[[[4,6-bis(difluoromethoxy)-2-pyrimidinyl]amino]carbonyl]amino]sulfonyl]benzoate |
| methyl 2-[4,6-bis(difluoromethoxy)pyrimidin-2-ylcarbamoylsulfamoyl]benzoate |
| methyl 2-({[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoyl}sulfamoyl)benzoate |