[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] prop-2-enoate structure
|
Common Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 86217-01-8 | Molecular Weight | 368.14400 | |
| Density | 1.523 | Boiling Point | 187ºC(lit.) | |
| Molecular Formula | C10H7F11O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.523 |
|---|---|
| Boiling Point | 187ºC(lit.) |
| Molecular Formula | C10H7F11O2 |
| Molecular Weight | 368.14400 |
| Exact Mass | 368.02700 |
| PSA | 26.30000 |
| LogP | 4.20920 |
| Index of Refraction | 1.343 |
| InChIKey | UXVXKXDSDYDRTQ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2916129000 |
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| r 3420 |