3-(BOC-AMINO)-3-(4-FLUOROPHENYL)-1-PROPANOL structure
|
Common Name | 3-(BOC-AMINO)-3-(4-FLUOROPHENYL)-1-PROPANOL | ||
|---|---|---|---|---|
| CAS Number | 862466-16-8 | Molecular Weight | 269.31200 | |
| Density | 1.14g/cm3 | Boiling Point | 407.8ºC at 760 mmHg | |
| Molecular Formula | C14H20FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.4ºC | |
| Name | tert-butyl N-[1-(4-fluorophenyl)-3-hydroxypropyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 407.8ºC at 760 mmHg |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.31200 |
| Flash Point | 200.4ºC |
| Exact Mass | 269.14300 |
| PSA | 58.56000 |
| LogP | 3.16480 |
| Index of Refraction | 1.508 |
| InChIKey | DUIAONVVNKFUPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCO)c1ccc(F)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [1-(4-fluoro-phenyl)-3-hydroxy-propyl]-carbamic acid tert-butyl ester |
| 3-(Boc-amino)-3-(4-fluorophenyl)-1-propanol |
| 3-N-Boc-amino-3-(4-fluoro-phenyl)-propan-1-ol |