WAY-658876 structure
|
Common Name | WAY-658876 | ||
|---|---|---|---|---|
| CAS Number | 863558-02-5 | Molecular Weight | 327.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-658876inhibitor of the human soluble epoxide hydrolase |
| Name | WAY-658876 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H25NO3 |
|---|---|
| Molecular Weight | 327.42 |
| InChIKey | ABTALAXWNWMKCX-UHFFFAOYSA-N |
| SMILES | O=C(NCC(c1cccnc1)N1CCN(c2ccc(F)cc2)CC1)c1ccc2c(c1)OCO2 |
| 1,3-Benzodioxole-5-carboxamide, N-[2-[4-(4-fluorophenyl)-1-piperazinyl]-2-(3-pyridinyl)ethyl]- |