Formaldehyde O-(pentafluorobenzyl)oxime
Formaldehyde O-(pentafluorobenzyl)oxime structure
|
Common Name | Formaldehyde O-(pentafluorobenzyl)oxime | ||
|---|---|---|---|---|
| CAS Number | 86356-73-2 | Molecular Weight | 225.115 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 193.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F5NO | Melting Point | 24 °C | |
| MSDS | Chinese USA | Flash Point | 70.5±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 193.0±50.0 °C at 760 mmHg |
| Melting Point | 24 °C |
| Molecular Formula | C8H4F5NO |
| Molecular Weight | 225.115 |
| Flash Point | 70.5±30.1 °C |
| Exact Mass | 225.021301 |
| PSA | 21.59000 |
| LogP | 3.36 |
| Vapour Pressure | 0.7±0.4 mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | SRTQFRQWTUMMTC-UHFFFAOYSA-N |
| SMILES | C=NOCc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 0-6°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Formaldehyde, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime |
| Formaldehyde, O-[(pentafluorophenyl)methyl]oxime |
| Formaldehyde O-(pentafluorobenzyl)oxime |
| MFCD00191477 |
| N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Boiling point of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 193.0±50.0 °C at 760 mmHg. |
| Q: What is the melting point of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Melting point of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 24 °C. |
| Q: What are the storage conditions for O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Storage conditions for O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime: 0-6°C. |
| Q: What is the molecular weight of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Molecular weight of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 225.115. |
| Q: What is the InChIKey of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: InChIKey of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is SRTQFRQWTUMMTC-UHFFFAOYSA-N. |
| Q: What is the LogP of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: LogP of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 3.36. |
| Q: What is the CAS number of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: CAS number of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 86356-73-2. |
| Q: What is the safety information for O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Safety information for O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime: S26. |
| Q: What is the molecular formula of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Molecular formula of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is C8H4F5NO. |
| Q: What is the polar surface area (PSA) of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime? |
| A: Polar surface area (PSA) of O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime is 21.59000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |