Formaldehyde O-(pentafluorobenzyl)oxime structure
|
Common Name | Formaldehyde O-(pentafluorobenzyl)oxime | ||
|---|---|---|---|---|
| CAS Number | 86356-73-2 | Molecular Weight | 225.115 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 193.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H4F5NO | Melting Point | 24 °C | |
| MSDS | Chinese USA | Flash Point | 70.5±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | O-(2,3,4,5,6-Pentafluorobenzyl)formaldoxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 193.0±50.0 °C at 760 mmHg |
| Melting Point | 24 °C |
| Molecular Formula | C8H4F5NO |
| Molecular Weight | 225.115 |
| Flash Point | 70.5±30.1 °C |
| Exact Mass | 225.021301 |
| PSA | 21.59000 |
| LogP | 3.36 |
| Vapour Pressure | 0.7±0.4 mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | SRTQFRQWTUMMTC-UHFFFAOYSA-N |
| SMILES | C=NOCc1c(F)c(F)c(F)c(F)c1F |
| Storage condition | 0-6°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Formaldehyde, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime |
| Formaldehyde, O-[(pentafluorophenyl)methyl]oxime |
| Formaldehyde O-(pentafluorobenzyl)oxime |
| MFCD00191477 |
| N-[(2,3,4,5,6-pentafluorophenyl)methoxy]methanimine |