(-)-GSK598809 hydrochloride structure
|
Common Name | (-)-GSK598809 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 863766-31-8 | Molecular Weight | 517.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24ClF4N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (-)-GSK598809 hydrochloride(-)-GSK598809 is an isomer of GSK598809. GSK598809 is a potent and selective dopamine D3 Receptor (DRD3) antagonist. |
| Name | (-)-GSK598809 hydrochloride |
|---|
| Description | (-)-GSK598809 is an isomer of GSK598809. GSK598809 is a potent and selective dopamine D3 Receptor (DRD3) antagonist. |
|---|---|
| Related Catalog | |
| Target |
D3 Receptor |
| References |
| Molecular Formula | C22H24ClF4N5OS |
|---|---|
| Molecular Weight | 517.97 |
| InChIKey | XHSASHVDEMJIMD-NVJCMEIXSA-N |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2CC3CC3(c3ccc(C(F)(F)F)cc3F)C2)n1C.Cl |
| Storage condition | -20°C |