4-Styrene Pentafluorophenoate structure
|
Common Name | 4-Styrene Pentafluorophenoate | ||
|---|---|---|---|---|
| CAS Number | 864069-04-5 | Molecular Weight | 314.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H7F5O2 | Melting Point | 39-44°C | |
| MSDS | Chinese USA | Flash Point | >110℃ | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | activated ester styrene |
|---|
| Melting Point | 39-44°C |
|---|---|
| Molecular Formula | C15H7F5O2 |
| Molecular Weight | 314.21 |
| Flash Point | >110℃ |
| InChIKey | QLSHRSPPXSAGTR-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| Storage condition | 2-8°C |
|
Covalently bonded layer-by-layer assembly of multifunctional thin films based on activated esters.
Langmuir 3rd ed., 26 , 1830-1836, (2010) We demonstrate that chemically stable, multifunctional polymer thin films can be obtained using the layer-by-layer (LbL) deposition based on covalent bonds between adsorbing chains. Poly(pentafluoroph... |
|
|
Nilles; et al.
J. Polym. Sci. A Polym. Chem. 6th ed., 47 , 1696-1705, (2009)
|