Fmoc-NH-ethyl-SS-propionic acid structure
|
Common Name | Fmoc-NH-ethyl-SS-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 864235-83-6 | Molecular Weight | 403.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-NH-ethyl-SS-propionic acidFmoc-NH-ethyl-SS-propionic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-NH-ethyl-SS-propionic acid |
|---|
| Description | Fmoc-NH-ethyl-SS-propionic acid is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C20H21NO4S2 |
|---|---|
| Molecular Weight | 403.52 |
| InChIKey | FXHUKQIBGGQHPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCSSCCNC(=O)OCC1c2ccccc2-c2ccccc21 |