N, N-Dimethyl-5-(piperazin-1-ylsulfonyl)naphthalen-1-amine structure
|
Common Name | N, N-Dimethyl-5-(piperazin-1-ylsulfonyl)naphthalen-1-amine | ||
|---|---|---|---|---|
| CAS Number | 86516-36-1 | Molecular Weight | 319.42200 | |
| Density | 1.263g/cm3 | Boiling Point | 490.727ºC at 760 mmHg | |
| Molecular Formula | C16H21N3O2S | Melting Point | 130-135ºC | |
| MSDS | N/A | Flash Point | 250.583ºC | |
| Name | 1-Dansylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 490.727ºC at 760 mmHg |
| Melting Point | 130-135ºC |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.42200 |
| Flash Point | 250.583ºC |
| Exact Mass | 319.13500 |
| PSA | 61.03000 |
| LogP | 2.84720 |
| Index of Refraction | 1.633 |
| InChIKey | NRTFFCBHBQNURK-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N3CCNCC3)cccc12 |
|
~95%
N, N-Dimethyl-5... CAS#:86516-36-1 |
| Literature: Sashuk, Volodymyr; Schoeps, Dirk; Plenio, Herbert Chemical Communications, 2009 , # 7 p. 770 - 772 |
|
~%
N, N-Dimethyl-5... CAS#:86516-36-1 |
| Literature: Stauffer, Shaun R.; Hartwig, John F. Journal of the American Chemical Society, 2003 , vol. 125, # 23 p. 6977 - 6985 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N,N-dimethyl-5-piperazin-1-ylsulfonylnaphthalen-1-amine |