3-Methyl-7-noradamantyllithium structure
|
Common Name | 3-Methyl-7-noradamantyllithium | ||
|---|---|---|---|---|
| CAS Number | 86550-17-6 | Molecular Weight | 142.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15Li | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methyl-7-noradamantyllithium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15Li |
|---|---|
| Molecular Weight | 142.16700 |
| Exact Mass | 142.13300 |
| LogP | 2.79090 |
| InChIKey | YCABTIBGTWLEHP-UHFFFAOYSA-N |
| SMILES | CC12CC3C[C-]1CC(C3)C2.[Li+] |
|
~51%
3-Methyl-7-nora... CAS#:86550-17-6
Detail
|
| Literature: Molle, Gerard; Bauer, Pierre Journal of the American Chemical Society, 1982 , vol. 104, # 12 p. 3481 - 3487 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Lithium,(hexahydro-6a-methyl-2,5-methanopentalen-3a(1H)-yl) |