Takeda103A structure
|
Common Name | Takeda103A | ||
|---|---|---|---|---|
| CAS Number | 865609-72-9 | Molecular Weight | 463.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23F2N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Takeda103ATakeda103A is a potent inhibitor of GRK2. G protein-coupled receptors (GPCRs) are central to many physiological processes. Takeda103A has the potential for the research of heart failure[1]. |
| Name | Takeda103A |
|---|
| Description | Takeda103A is a potent inhibitor of GRK2. G protein-coupled receptors (GPCRs) are central to many physiological processes. Takeda103A has the potential for the research of heart failure[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H23F2N7O |
|---|---|
| Molecular Weight | 463.48 |
| InChIKey | VWBSMGFTNCQOMB-UHFFFAOYSA-N |
| SMILES | CCCn1c(CNc2cccc(C(=O)NCc3c(F)cccc3F)c2)nnc1-c1ccncn1 |