4-[2-(2,6-dibromophenoxy)ethoxy]benzonitrile structure
|
Common Name | 4-[2-(2,6-dibromophenoxy)ethoxy]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 865756-52-1 | Molecular Weight | 397.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(2,6-dibromophenoxy)ethoxy]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11Br2NO2 |
|---|---|
| Molecular Weight | 397.06100 |
| Exact Mass | 394.91600 |
| PSA | 42.25000 |
| LogP | 4.54108 |
| InChIKey | DVMRASJJAUSLGS-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(OCCOc2c(Br)cccc2Br)cc1 |
|
~88%
4-[2-(2,6-dibro... CAS#:865756-52-1 |
| Literature: Tominaga, Masahide; Suzuki, Kosuke; Murase, Takashi; Fujita, Makoto Journal of the American Chemical Society, 2005 , vol. 127, # 34 p. 11950 - 11951 |
|
~%
4-[2-(2,6-dibro... CAS#:865756-52-1 |
| Literature: Tominaga, Masahide; Suzuki, Kosuke; Murase, Takashi; Fujita, Makoto Journal of the American Chemical Society, 2005 , vol. 127, # 34 p. 11950 - 11951 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzonitrile,4-[2-(2,6-dibromophenoxy)ethoxy] |
| 1,3-dibromo-2-[4-(p-cyanophenyl)-1,4-dioxabutyl]benzene |