Tricyclo[3.3.1.13,7]decane-1-carboxamide,N,N'-1,5-pentanediylbis- structure
|
Common Name | Tricyclo[3.3.1.13,7]decane-1-carboxamide,N,N'-1,5-pentanediylbis- | ||
|---|---|---|---|---|
| CAS Number | 86583-06-4 | Molecular Weight | 426.63500 | |
| Density | 1.154g/cm3 | Boiling Point | 658.6ºC at 760mmHg | |
| Molecular Formula | C27H42N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | N-[5-(adamantane-1-carbonylamino)pentyl]adamantane-1-carboxamide |
|---|
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 658.6ºC at 760mmHg |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.63500 |
| Flash Point | 193.6ºC |
| Exact Mass | 426.32500 |
| PSA | 58.20000 |
| LogP | 5.60370 |
| Index of Refraction | 1.572 |
| InChIKey | MCDFFPDKTCJLDL-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCCNC(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
|
~66%
Tricyclo[3.3.1.... CAS#:86583-06-4 |
| Literature: Antoniadou-Vyzas; Foscolos; Chytiroglou-Ladas European Journal of Medicinal Chemistry, 1986 , vol. 21, # 1 p. 73 - 74 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |