adamantanecarbonyl chloride structure
|
Common Name | adamantanecarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2094-72-6 | Molecular Weight | 198.689 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 270.6±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H15ClO | Melting Point | 49-51 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.0±8.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | adamantane-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.6±0.0 °C at 760 mmHg |
| Melting Point | 49-51 °C(lit.) |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.689 |
| Flash Point | 139.0±8.3 °C |
| Exact Mass | 198.081146 |
| PSA | 17.07000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | MIBQYWIOHFTKHD-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C12CC3CC(CC(C3)C1)C2 |
| Storage condition | 2-8°C |
| Water Solubility | may decompose |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Supplemental HS | Reacts violently with water. |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R14;R34;R37 |
| Safety Phrases | S26-S36/37/39-S45-S24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2915900090 |
|
~99%
adamantanecarbo... CAS#:2094-72-6 |
| Literature: Guo, Jian Wei; Zhong, Xing; Zhu, Hua; Feng, Li Juan; De Cui, Ying Chinese Chemical Letters, 2012 , vol. 23, # 6 p. 653 - 656 |
|
~%
adamantanecarbo... CAS#:2094-72-6 |
| Literature: Journal of Organic Chemistry, , vol. 47, # 21 p. 4120 - 4128 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Efficient preparation of amine-modified oligodeoxynucleotide using modified H-phosphonate chemistry for DNA microarray fabrication.
Anal. Bioanal. Chem 387(6) , 2027-35, (2007) Amine-modified oligodeoxynucleotides (AMO) are commonly used probe oligodeoxynucleotides for DNA microarray preparation. Two methods are currently used for AMO preparation--use of amine phosphoramidit... |
|
|
Novel activating and capping reagents for improved hydrogen-phosphonate DNA synthesis. Andrus A, et al.
Tetrahedron Lett. 29(8) , 861-864, (1988)
|
|
|
Highly selective catalytic Friedel-Crafts acylation and sulfonylation of activated aromatic compounds using indium metal. Jang DO, et al.
Tetrahedron Lett. 47(34) , 6063-6066, (2006)
|
| EINECS 218-252-7 |
| Adamantane-1-carbonyl chloride |
| 1-Adamantanecarboxlic acid chloride |
| adamantanecarboxylic acid chloride |
| 1-Adamantanoic acid chloride |
| adamantanecarbonyl chloride |
| Tricyclo[3.3.1.1]decane-1-carbonyl chloride |
| MFCD00074724 |
| 1-AdamantanecarbonylChloride |
| Adamantane-1-carboxylic acid chloride |
| 1-Adamantanecarbonyl chloride |
| 1-Adamantyl carbonyl chloride |
| 1-Adamantanecarboxylic acid chloride |
| 1-Adamantoyl chloride |
| 1-ADAMANTYLCARBONYL CHLORIDE |
| Adamantoyl chloride |