2-chloro-2,3,3-trifluorobutanedioic acid structure
|
Common Name | 2-chloro-2,3,3-trifluorobutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 866-16-0 | Molecular Weight | 206.50400 | |
| Density | 1.849 g/cm3 | Boiling Point | 197.2ºC at 760mmHg | |
| Molecular Formula | C4H2ClF3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 73.1ºC | |
| Name | 2-chloro-2,3,3-trifluorobutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.849 g/cm3 |
|---|---|
| Boiling Point | 197.2ºC at 760mmHg |
| Molecular Formula | C4H2ClF3O4 |
| Molecular Weight | 206.50400 |
| Flash Point | 73.1ºC |
| Exact Mass | 205.95900 |
| PSA | 74.60000 |
| LogP | 0.69550 |
| Index of Refraction | 1.432 |
| InChIKey | AWSACKQBEIHEPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(Cl)C(=O)O |
| Risk Phrases | R34 |
|---|---|
| Safety Phrases | S26-S36/37/39-S45 |
| HS Code | 2917190090 |
|
~80%
2-chloro-2,3,3-... CAS#:866-16-0 |
| Literature: Abdo, Basil T. Journal of Physical Chemistry A, 1999 , vol. 103, # 12 p. 1758 - 1767 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Trifluor-chlor-bernsteinsaeure |
| Butanedioic acid,2-chloro-2,3,3-trifluoro |
| 2-chloro-2,3,3-trifluorosuccinic acid |
| Chlortrifluorbernsteinsaeure |
| CHLOROTRIFLUOROSUCCINIC ACID |