4,4',4''-tris(benzoyloxy)trityl bromide structure
|
Common Name | 4,4',4''-tris(benzoyloxy)trityl bromide | ||
|---|---|---|---|---|
| CAS Number | 86610-66-4 | Molecular Weight | 683.54300 | |
| Density | 1.377g/cm3 | Boiling Point | 761.8ºC at 760 mmHg | |
| Molecular Formula | C40H27BrO6 | Melting Point | 187-189ºC(lit.) | |
| MSDS | N/A | Flash Point | 414.5ºC | |
| Name | [4-[bis(4-benzoyloxyphenyl)-bromomethyl]phenyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 761.8ºC at 760 mmHg |
| Melting Point | 187-189ºC(lit.) |
| Molecular Formula | C40H27BrO6 |
| Molecular Weight | 683.54300 |
| Flash Point | 414.5ºC |
| Exact Mass | 682.09900 |
| PSA | 78.90000 |
| LogP | 9.03100 |
| Index of Refraction | 1.655 |
| InChIKey | PKXTVZCJOBWKIG-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(C(Br)(c2ccc(OC(=O)c3ccccc3)cc2)c2ccc(OC(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
|
~94%
4,4',4''-tris(b... CAS#:86610-66-4 |
| Literature: Sekine, Mitsuo; Hata, Tsujiaki Journal of Organic Chemistry, 1983 , vol. 48, # 18 p. 3011 - 3014 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00010302 |
| Tris[4-(phenylcarbonyloxy)phenyl]methyl Bromide |
| 4,4',4''-Tris(benzoyloxy)trityl bromide |