6-Chloro-N,N-dimethyl-2-(trifluoromethyl)pyrimidin-4-amine structure
|
Common Name | 6-Chloro-N,N-dimethyl-2-(trifluoromethyl)pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 866648-53-5 | Molecular Weight | 225.599 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 217.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H7ClF3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85.6±27.3 °C | |
| Name | 6-chloro-N,N-dimethyl-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 217.9±40.0 °C at 760 mmHg |
| Molecular Formula | C7H7ClF3N3 |
| Molecular Weight | 225.599 |
| Flash Point | 85.6±27.3 °C |
| Exact Mass | 225.028061 |
| PSA | 29.02000 |
| LogP | 1.78 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | RCRUAWWNTTTYOS-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(Cl)nc(C(F)(F)F)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~%
6-Chloro-N,N-di... CAS#:866648-53-5 |
| Literature: WO2005/95357 A2, ; Page/Page column 140; 141 ; WO 2005/095357 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-N,N-dimethyl-2-(trifluoromethyl)pyrimidin-4-amine |
| 6-Chloro-N,N-dimethyl-2-(trifluoromethyl)-4-pyrimidinamine |