L-Glutamic acid, N-[4-[[N-(2, 4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-, bis[(2, 6-dichlorophenyl)methyl] ester structure
|
Common Name | L-Glutamic acid, N-[4-[[N-(2, 4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-, bis[(2, 6-dichlorophenyl)methyl] ester | ||
|---|---|---|---|---|
| CAS Number | 86669-36-5 | Molecular Weight | 772.46500 | |
| Density | 1.498g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H30Cl4N8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[(2,6-dichlorophenyl)methyl] 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.498g/cm3 |
|---|---|
| Molecular Formula | C34H30Cl4N8O5 |
| Molecular Weight | 772.46500 |
| Exact Mass | 770.10900 |
| PSA | 188.54000 |
| LogP | 7.75290 |
| Index of Refraction | 1.69 |
| InChIKey | OMFGEIYTGJZTEH-UHFFFAOYSA-N |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)OCc2c(Cl)cccc2Cl)C(=O)OCc2c(Cl)cccc2Cl)cc1 |
|
~62%
L-Glutamic acid... CAS#:86669-36-5 |
| Literature: Rosowsky, A.; Yu, C.-S. Journal of Medicinal Chemistry, 1983 , vol. 26, # 10 p. 1448 - 1452 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis(2,6-dichlorobenzyl) methotrexate |
| L-Glutamic acid,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-,bis[(2,6-dichlorophenyl)methyl] ester |