2-(2-Methoxyethoxy)ethyl 2-(chlorosulfonyl)benzoate structure
|
Common Name | 2-(2-Methoxyethoxy)ethyl 2-(chlorosulfonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 866942-11-2 | Molecular Weight | 322.76200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClO6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-(2-methoxyethoxy)ethyl 2-chlorosulfonylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15ClO6S |
|---|---|
| Molecular Weight | 322.76200 |
| Exact Mass | 322.02800 |
| PSA | 87.28000 |
| LogP | 2.51470 |
| InChIKey | TVQUWKKLSJIKOI-UHFFFAOYSA-N |
| SMILES | COCCOCCOC(=O)c1ccccc1S(=O)(=O)Cl |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314-H332 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| RIDADR | UN 3265 8 / PGIII |
| HS Code | 2916399090 |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~96%
2-(2-Methoxyeth... CAS#:866942-11-2 |
| Literature: Lepore, Salvatore D.; Bhunia, Anjan K.; Mondal, Deboprosad; Cohn, Pamela C.; Lefkowitz, Craig Journal of Organic Chemistry, 2006 , vol. 71, # 8 p. 3285 - 3286 |
|
~%
2-(2-Methoxyeth... CAS#:866942-11-2 |
| Literature: FLORIDA ATLANTIC UNIVERSITY Patent: WO2006/60142 A2, 2006 ; Location in patent: Page/Page column 20-21 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-dioxoheptyl 2-(chlorosulfonyl)benzoate |
| 2-(2-Methoxyethoxy)ethyl 2-(chlorosulfonyl)benzoate |
| 3,6-dioxaheptyl 2-(chlorosulfonyl)benzoate |
| Benzoic acid,2-(chlorosulfonyl)-,2-(2-methoxyethoxy)ethyl ester |
| methoxyethoxyethyl 2-(chlorosulfonyl)benzoate |