2-aza-2-dihydrosqualene structure
|
Common Name | 2-aza-2-dihydrosqualene | ||
|---|---|---|---|---|
| CAS Number | 86699-73-2 | Molecular Weight | 413.72200 | |
| Density | 0.859g/cm3 | Boiling Point | 494ºC at 760 mmHg | |
| Molecular Formula | C29H51N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.9ºC | |
| Name | (4Z,8Z,12Z,16Z)-N,N,4,8,13,17,21-heptamethyldocosa-4,8,12,16,20-pentaen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.859g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760 mmHg |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.72200 |
| Flash Point | 219.9ºC |
| Exact Mass | 413.40200 |
| PSA | 3.24000 |
| LogP | 9.20040 |
| Index of Refraction | 1.491 |
| InChIKey | OBYAAZRQFIVRJS-SSBIOBDKSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCCN(C)C |
|
~%
2-aza-2-dihydro... CAS#:86699-73-2 |
| Literature: Ceruti, Maurizio; Balliano, Gianni; Viola, Franca; Cattel, Luigi; Gerst, Nicolas; Schuber, Francis European Journal of Medicinal Chemistry, 1987 , vol. 22, p. 199 - 208 |
|
~%
2-aza-2-dihydro... CAS#:86699-73-2 |
| Literature: Ceruti, Maurizio; Balliano, Gianni; Viola, Franca; Cattel, Luigi; Gerst, Nicolas; Schuber, Francis European Journal of Medicinal Chemistry, 1987 , vol. 22, p. 199 - 208 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Azasqualene |
| 2-Aza-2,3-dihydrosqualene |
| 4,8,12,16,20-Docosapentaen-1-amine,N,N,4,8,13,17,21-heptamethyl-,(all-E) |
| 2-Aza-2-dihydrosqualene |