N,N-diethylazasqualene structure
|
Common Name | N,N-diethylazasqualene | ||
|---|---|---|---|---|
| CAS Number | 86699-75-4 | Molecular Weight | 441.77500 | |
| Density | 0.858g/cm3 | Boiling Point | 518.7ºC at 760 mmHg | |
| Molecular Formula | C31H55N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.3ºC | |
| Name | (4Z,8Z,12Z,16Z)-N,N-diethyl-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.858g/cm3 |
|---|---|
| Boiling Point | 518.7ºC at 760 mmHg |
| Molecular Formula | C31H55N |
| Molecular Weight | 441.77500 |
| Flash Point | 231.3ºC |
| Exact Mass | 441.43300 |
| PSA | 3.24000 |
| LogP | 9.98060 |
| Index of Refraction | 1.49 |
| InChIKey | DYTYGLWXXSHWDM-ALKIISATSA-N |
| SMILES | CCN(CC)CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
|
~%
N,N-diethylazas... CAS#:86699-75-4 |
| Literature: Ceruti, Maurizio; Balliano, Gianni; Viola, Franca; Cattel, Luigi; Gerst, Nicolas; Schuber, Francis European Journal of Medicinal Chemistry, 1987 , vol. 22, p. 199 - 208 |
|
~%
N,N-diethylazas... CAS#:86699-75-4 |
| Literature: Ceruti, Maurizio; Balliano, Gianni; Viola, Franca; Cattel, Luigi; Gerst, Nicolas; Schuber, Francis European Journal of Medicinal Chemistry, 1987 , vol. 22, p. 199 - 208 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-Diethylazasqualene |
| 4,8,12,16,20-Docosapentaen-1-amine,N,N-diethyl-4,8,13,17,21-pentamethyl-,(all-E) |
| N,N-Diethyl-4,8,13,17,21-pentamethyl-4,8,12,16,20-docosapentaen-1-amine (all-E) |
| squalene diethylamine: N,N-diethyl-4,8,13,17,21-pentamethyl-4,8,12,16,20-docosapentaenylamine (all E) |
| DAZS |