WAY-381244
Modify Date: 2025-10-21 20:41:12
WAY-381244 structure
|
Common Name | WAY-381244 | ||
|---|---|---|---|---|
| CAS Number | 867157-14-0 | Molecular Weight | 453.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H14F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-381244agonists for the G protein-coupled receptor GPR132 |
| Name | WAY-381244 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H14F3NO5 |
|---|---|
| Molecular Weight | 453.37 |
| InChIKey | JBYSJAVPDOVKAV-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccc(C(F)(F)F)cc1)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| Benzoic acid, 4-(trifluoromethyl)-, 2-[(9,10-dihydro-9,10-dioxo-2-anthracenyl)amino]-2-oxoethyl ester |