WAY-659763 structure
|
Common Name | WAY-659763 | ||
|---|---|---|---|---|
| CAS Number | 867329-47-3 | Molecular Weight | 273.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-659763cytotoxic and antiproliferative activities gainst BMEC and HUVEC |
| Name | WAY-659763 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19NO3 |
|---|---|
| Molecular Weight | 273.33 |
| InChIKey | SYQPNRXVAWNHCI-UHFFFAOYSA-N |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)c2ccccc2O)c1C |
| Benzoic acid, 2-hydroxy-, 2-[2,5-dimethyl-1-(2-propen-1-yl)-1H-pyrrol-3-yl]-2-oxoethyl ester |