diethyl 2,9-dibromodecanedioate structure
|
Common Name | diethyl 2,9-dibromodecanedioate | ||
|---|---|---|---|---|
| CAS Number | 868-71-3 | Molecular Weight | 416.14600 | |
| Density | 1.416g/cm3 | Boiling Point | 367.9ºC at 760 mmHg | |
| Molecular Formula | C14H24Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | diethyl 2,9-dibromodecanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 367.9ºC at 760 mmHg |
| Molecular Formula | C14H24Br2O4 |
| Molecular Weight | 416.14600 |
| Flash Point | 176.3ºC |
| Exact Mass | 414.00400 |
| PSA | 52.60000 |
| LogP | 3.98020 |
| Index of Refraction | 1.496 |
| InChIKey | ODDKGDUYOMCJEH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Br)CCCCCCC(Br)C(=O)OCC |
|
~%
diethyl 2,9-dib... CAS#:868-71-3 |
| Literature: Le Sueur; Haas Journal of the Chemical Society, 1910 , vol. 97, p. 181 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,9-Dibrom-decandisaeure-diaethylester |
| Decanedioic acid,2,9-dibromo-,diethyl ester |
| 2,9-dibromo-decanedioic acid diethyl ester |