Ethyl 3-(4-bromophenyl)-alpha-methyl-2H-1,4-benzoxazine-6-acetate structure
|
Common Name | Ethyl 3-(4-bromophenyl)-alpha-methyl-2H-1,4-benzoxazine-6-acetate | ||
|---|---|---|---|---|
| CAS Number | 86818-24-8 | Molecular Weight | 388.25500 | |
| Density | 1.39g/cm3 | Boiling Point | 469.3ºC at 760 mmHg | |
| Molecular Formula | C19H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.6ºC | |
| Name | Ethyl 2-[3-(4-bromophenyl)-2H-1,4-benzoxazin-6-yl]propanoate |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 469.3ºC at 760 mmHg |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.25500 |
| Flash Point | 237.6ºC |
| Exact Mass | 387.04700 |
| PSA | 47.89000 |
| LogP | 4.06450 |
| Index of Refraction | 1.607 |
| InChIKey | RNJMGKNUJSXXKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)c1ccc2c(c1)N=C(c1ccc(Br)cc1)CO2 |
|
~49%
Ethyl 3-(4-brom... CAS#:86818-24-8 |
| Literature: Shridhar, D. R.; Sastry, C. V. Reddy; Bansal, O. P.; Rao, P. Pulla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 3 p. 297 - 299 |