4',5-dichloro-2-hydroxy-3-methylbenzophenone structure
|
Common Name | 4',5-dichloro-2-hydroxy-3-methylbenzophenone | ||
|---|---|---|---|---|
| CAS Number | 86914-72-9 | Molecular Weight | 281.13400 | |
| Density | 1.363g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
| Name | (5-chloro-2-hydroxy-3-methylphenyl)-(4-chlorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.13400 |
| Flash Point | 204.3ºC |
| Exact Mass | 280.00600 |
| PSA | 37.30000 |
| LogP | 4.23840 |
| Index of Refraction | 1.621 |
| InChIKey | LNAURVNIKFHZNB-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)cc(C(=O)c2ccc(Cl)cc2)c1O |
| HS Code | 2914700090 |
|---|
|
~%
4',5-dichloro-2... CAS#:86914-72-9 |
| Literature: Synthelabo Patent: US4588748 A1, 1986 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5-chloro-2-hydroxy-3-methylphenyl 4-chlorophenyl ketone |
| 4',5-Dichloro-2-hydroxy-3-methylbenzophenone |
| EINECS 289-287-3 |
| (5-chloro-2-hydroxy-3-methylphenyl)-(4-chlorophenyl)-methanone |