4',5-dichloro-2-hydroxychalcone structure
|
Common Name | 4',5-dichloro-2-hydroxychalcone | ||
|---|---|---|---|---|
| CAS Number | 93942-33-7 | Molecular Weight | 293.14500 | |
| Density | 1.381g/cm3 | Boiling Point | 468.4ºC at 760 mmHg | |
| Molecular Formula | C15H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.1ºC | |
| Name | (E)-3-(5-chloro-2-hydroxyphenyl)-1-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 468.4ºC at 760 mmHg |
| Molecular Formula | C15H10Cl2O2 |
| Molecular Weight | 293.14500 |
| Flash Point | 237.1ºC |
| Exact Mass | 292.00600 |
| PSA | 37.30000 |
| LogP | 4.59510 |
| Index of Refraction | 1.664 |
| InChIKey | FDICQHLLNKLPEY-XVNBXDOJSA-N |
| SMILES | O=C(C=Cc1cc(Cl)ccc1O)c1ccc(Cl)cc1 |
|
~%
4',5-dichloro-2... CAS#:93942-33-7 |
| Literature: Liu, Jia-Jia; Zhang, Hui; Sun, Juan; Wang, Zhong-Chang; Yang, Yu-Shun; Li, Dong-Dong; Zhang, Fei; Gong, Hai-Bin; Zhu, Hai-Liang Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 20 p. 6089 - 6096 |
| EINECS 300-585-5 |
| 4',5-Dichloro-2-hydroxychalcone |