8-Acetyl-6-benzyloxy-4H-benzo[1,4]oxazin-3-one structure
|
Common Name | 8-Acetyl-6-benzyloxy-4H-benzo[1,4]oxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 869478-09-1 | Molecular Weight | 297.305 | |
| Density | 1.259±0.06 g/cm3 | Boiling Point | 517.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6±30.1 °C | |
| Name | 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259±0.06 g/cm3 |
|---|---|
| Boiling Point | 517.2±50.0 °C at 760 mmHg |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.305 |
| Flash Point | 266.6±30.1 °C |
| Exact Mass | 297.100098 |
| PSA | 68.12000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | URTYAHMRXXVHKS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(OCc2ccccc2)cc2c1OCC(=O)N2 |
| Storage condition | 2~8℃ |
| Water Solubility | Practically insoluble (0.083 g/L) (25 ºC) |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~64%
8-Acetyl-6-benz... CAS#:869478-09-1 |
| Literature: Bouyssou, Thierry; Hoenke, Christoph; Rudolf, Klaus; Lustenberger, Philipp; Pestel, Sabine; Sieger, Peter; Lotz, Ralf; Heine, Claudia; Buettner, Frank H.; Schnapp, Andreas; Konetzki, Ingo Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 4 p. 1410 - 1414 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-1,4-Benzoxazin-3(4H)-one, 8-acetyl-6-(phenylmethoxy)- |
| 8-Acetyl-6-(benzyloxy)-2H-1,4-benzoxazin-3(4H)-one |
| 8-Acetyl-6-benzyloxy-4H-benzo[1,4]oxazin-3-one |