(Z)-2-(2-tert-Butoxycarbonylaminothiazol-4-yl)-2-pentenoic acid structure
|
Common Name | (Z)-2-(2-tert-Butoxycarbonylaminothiazol-4-yl)-2-pentenoic acid | ||
|---|---|---|---|---|
| CAS Number | 86978-24-7 | Molecular Weight | 298.358 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O4S | Melting Point | 159-161ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (Z)-2-(2-((tert-Butoxycarbonyl)amino)thiazol-4-yl)pent-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 159-161ºC |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.358 |
| Exact Mass | 298.098724 |
| PSA | 116.76000 |
| LogP | 3.15 |
| Index of Refraction | 1.584 |
| InChIKey | XIXNSLABECPEMI-VURMDHGXSA-N |
| SMILES | CCC=C(C(=O)O)c1csc(NC(=O)OC(C)(C)C)n1 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2942000000 |
|
~90%
(Z)-2-(2-tert-B... CAS#:86978-24-7 |
| Literature: Zhai, Jiao-Jiao; Jiang, Jian-An; Zhang, Shun-Li; Chen, Cheng; Liu, Hong-Wei; Liao, Dao-Hua; Ji, Ya-Fei Synlett, 2013 , vol. 24, # 11 art. no. ST-2013-W0232-L, p. 1399 - 1404 |
|
~%
(Z)-2-(2-tert-B... CAS#:86978-24-7 |
| Literature: Journal of Antibiotics, , vol. 47, # 4 p. 453 - 465 |
|
~%
(Z)-2-(2-tert-B... CAS#:86978-24-7 |
| Literature: Journal of Antibiotics, , vol. 47, # 4 p. 453 - 465 |
|
~%
(Z)-2-(2-tert-B... CAS#:86978-24-7 |
| Literature: Synlett, , vol. 24, # 11 art. no. ST-2013-W0232-L, p. 1399 - 1404 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (2Z)-2-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-1,3-thiazol-4-yl]-2-pentenoic acid |
| MFCD00062759 |
| T5N CSJ BMVOX1&1&1 EYVQU3 &&Z Form |
| (2Z)-2-{2-[(tert-Butoxycarbonyl)amino]-1,3-thiazol-4-yl}pent-2-enoic acid |
| 4-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-α-propylidene-, (αZ)- |
| (Z)-2-(2-tert-Butoxycarbonylaminothiazol-4-yl)-2-pentenoic acid |
| (αZ)-2-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-propylidene-4-thiazoleacetate |
| (Z)-2-{2-[(tert-Butoxycarbonyl)amino]thiazol-4-yl}pent-2-enoic acid |
| EINECS 430-100-3 |