WAY-326250 structure
|
Common Name | WAY-326250 | ||
|---|---|---|---|---|
| CAS Number | 869872-13-9 | Molecular Weight | 311.36162 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-326250altering the lifespan of a eukaryotic organism; Mycobacterium tuberculosis shikimate kinase inhibitor; |
| Name | WAY-326250 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13N5OS |
|---|---|
| Molecular Weight | 311.36162 |
| InChIKey | VLCAVVSOZVVTLN-UHFFFAOYSA-N |
| SMILES | CCc1cccc(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)c1 |
| Pyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide, N-(3-ethylphenyl)-3,4-dihydro-, 2,2-dioxide |