2,2μ-Bis[4-(trifluoromethyl)phenyl]-5,5μ-bithiazole structure
|
Common Name | 2,2μ-Bis[4-(trifluoromethyl)phenyl]-5,5μ-bithiazole | ||
|---|---|---|---|---|
| CAS Number | 869896-76-4 | Molecular Weight | 456.427 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 529.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H10F6N2S2 | Melting Point | 230-235°C | |
| MSDS | USA | Flash Point | 274.0±32.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2,2'-Bis[4-(trifluoromethyl)phenyl]-5,5'-bi-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.5±60.0 °C at 760 mmHg |
| Melting Point | 230-235°C |
| Molecular Formula | C20H10F6N2S2 |
| Molecular Weight | 456.427 |
| Flash Point | 274.0±32.9 °C |
| Exact Mass | 456.018951 |
| LogP | 7.96 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | YPPDUFZJMJWOLJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(-c2ncc(-c3cnc(-c4ccc(C(F)(F)F)cc4)s3)s2)cc1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| Hazard Codes | T |
| RIDADR | UN 2811 6.1 / PGIII |
|
n-type organic field-effect transistors with very high electron mobility based on thiazole oligomers with trifluoromethylphenyl groups.
J. Am. Chem. Soc. 127 , 14996-14997, (2005) Novel thiazole oligomers and thiazole/thiophene co-oligomers with trifluoromethylphenyl groups were developed as n-type semiconductors for OFETs. They showed excellent n-type performances with high el... |
| 5,5'-Bithiazole, 2,2'-bis[4-(trifluoromethyl)phenyl]- |
| 2,2'-Bis[4-(trifluoromethyl)phenyl]-5,5'-bi-1,3-thiazole |