2-Phenylethyl salicylate
2-Phenylethyl salicylate structure
|
Common Name | 2-Phenylethyl salicylate | ||
|---|---|---|---|---|
| CAS Number | 87-22-9 | Molecular Weight | 242.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 377.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | 39-41ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 158.3±15.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-phenylethyl 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.9±25.0 °C at 760 mmHg |
| Melting Point | 39-41ºC(lit.) |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 158.3±15.9 °C |
| Exact Mass | 242.094299 |
| PSA | 46.53000 |
| LogP | 4.26 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | YNMSDIQQNIRGDP-UHFFFAOYSA-N |
| SMILES | O=C(OCCc1ccccc1)c1ccccc1O |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| HS Code | 2918230000 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918230000 |
|---|---|
| Summary | 2918230000 other esters of salicylic acid and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antagonist activity at human OR5K1 expressed in HEK293 cells assessed as inhibition o...
Source: ChEMBL
Target: Olfactory receptor 5K1
External Id: CHEMBL3734176
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| phenyl ethyl salicylate |
| 2-Phenylethyl salicylate |
| Phenylethyl salicyalte |
| β-Phenylethyl salicylate |
| 2-hydroxy-benzoic acid,2-phenylethyl ester |
| Salicylic acid, phenethyl ester (8CI) |
| Benzyl carbinyl salicylate |
| Phenaethylsalicylat |
| Salicylsaeure-phenaethylester |
| Salicylic acid,phenethyl ester |
| Salicylic acid, phenethyl ester |
| Benzoic acid, 2-hydroxy-, 2-phenylethyl ester |
| 2-phenylethyl 2-hydroxybenzoate |
| Phenethyl salicylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-phenylethyl 2-hydroxybenzoate? |
| A: Molecular weight of 2-phenylethyl 2-hydroxybenzoate is 242.270. |
| Q: What is the melting point of 2-phenylethyl 2-hydroxybenzoate? |
| A: Melting point of 2-phenylethyl 2-hydroxybenzoate is 39-41ºC(lit.). |
| Q: What English synonyms does 2-phenylethyl 2-hydroxybenzoate have? |
| A: English synonyms of 2-phenylethyl 2-hydroxybenzoate: phenyl ethyl salicylate, 2-Phenylethyl salicylate, Phenylethyl salicyalte, β-Phenylethyl salicylate, 2-hydroxy-benzoic acid,2-phenylethyl ester, Salicylic acid, phenethyl ester (8CI), Benzyl carbinyl salicylate, Phenaethylsalicylat, Salicylsaeure-phenaethylester, Salicylic acid,phenethyl ester, Salicylic acid, phenethyl ester, Benzoic acid, 2-hydroxy-, 2-phenylethyl ester, 2-phenylethyl 2-hydroxybenzoate, Phenethyl salicylate. |
| Q: What is the boiling point of 2-phenylethyl 2-hydroxybenzoate? |
| A: Boiling point of 2-phenylethyl 2-hydroxybenzoate is 377.9±25.0 °C at 760 mmHg. |
| Q: What is the SMILES notation of 2-phenylethyl 2-hydroxybenzoate? |
| A: SMILES notation of 2-phenylethyl 2-hydroxybenzoate is O=C(OCCc1ccccc1)c1ccccc1O. |
| Q: What is the safety information for 2-phenylethyl 2-hydroxybenzoate? |
| A: Safety information for 2-phenylethyl 2-hydroxybenzoate: 26-36. |
| Q: What is the polar surface area (PSA) of 2-phenylethyl 2-hydroxybenzoate? |
| A: Polar surface area (PSA) of 2-phenylethyl 2-hydroxybenzoate is 46.53000. |
| Q: What is the InChIKey of 2-phenylethyl 2-hydroxybenzoate? |
| A: InChIKey of 2-phenylethyl 2-hydroxybenzoate is YNMSDIQQNIRGDP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-phenylethyl 2-hydroxybenzoate? |
| A: Molecular formula of 2-phenylethyl 2-hydroxybenzoate is C15H14O3. |
| Q: What is the CAS number of 2-phenylethyl 2-hydroxybenzoate? |
| A: CAS number of 2-phenylethyl 2-hydroxybenzoate is 87-22-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |