2,3,4,5,6-PENTABROMOTOLUENE structure
|
Common Name | 2,3,4,5,6-PENTABROMOTOLUENE | ||
|---|---|---|---|---|
| CAS Number | 87-83-2 | Molecular Weight | 486.619 | |
| Density | 2.6±0.1 g/cm3 | Boiling Point | 394.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Br5 | Melting Point | 285-286 °C(lit.) | |
| MSDS | N/A | Flash Point | 186.5±21.2 °C | |
| Name | 2,3,4,5,6-pentabromotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.4±37.0 °C at 760 mmHg |
| Melting Point | 285-286 °C(lit.) |
| Molecular Formula | C7H3Br5 |
| Molecular Weight | 486.619 |
| Flash Point | 186.5±21.2 °C |
| Exact Mass | 481.615112 |
| LogP | 5.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | OZHJEQVYCBTHJT-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)c(Br)c(Br)c(Br)c1Br |
| Stability | Stable. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| RTECS | DA6639500 |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3',4,4',5,5'-HEXACB UNLABELED |
| EINECS 201-774-4 |
| Flammex 5BT |
| 2,3,4,5,6-pentabromo-toluene |
| 2,3,4,5,6-PENTABROMTOLUOL |
| 2,3,4,5,6-PENTABROMO |
| MFCD00000060 |
| pentabromomethyl-benzene |
| PENTABROMOTOLUENE |
| Flamex 5BT |
| 1,2,3,4,5-PENTABROMOTOLUENE |
| 1,2,3,4,5-Pentabromo-6-methylbenzene |
| 2,3,4,5,6-PENTABROMOTOLUENE |