Methyl 4-(2-acetamidoethyl)benzoate structure
|
Common Name | Methyl 4-(2-acetamidoethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 870703-69-8 | Molecular Weight | 221.25200 | |
| Density | 1.111g/cm3 | Boiling Point | 425.6ºC at 760 mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | 89-93ºC | |
| MSDS | Chinese USA | Flash Point | 211.2ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | Methyl 4-(2-acetamidoethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 425.6ºC at 760 mmHg |
| Melting Point | 89-93ºC |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 211.2ºC |
| Exact Mass | 221.10500 |
| PSA | 58.89000 |
| LogP | 1.99210 |
| Index of Refraction | 1.519 |
| InChIKey | NNHJGOJEUOUOFH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CCNC(C)=O)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 37/38-41 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl 4-(2-acetylaminoethyl)benzoate |
| 4-(2-Acetylaminoethyl)benzoic acid methyl ester |