2-BROMO-2',6'-DIISOPROPOXY-1,1'-BIPHENYL structure
|
Common Name | 2-BROMO-2',6'-DIISOPROPOXY-1,1'-BIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 870703-70-1 | Molecular Weight | 349.26200 | |
| Density | 1.231 g/mL at 25ºC | Boiling Point | 140ºC/0.2 mmHg | |
| Molecular Formula | C18H21BrO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | 2-(2-bromophenyl)-1,3-di(propan-2-yloxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231 g/mL at 25ºC |
|---|---|
| Boiling Point | 140ºC/0.2 mmHg |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.26200 |
| Flash Point | 110ºC |
| Exact Mass | 348.07200 |
| PSA | 18.46000 |
| LogP | 5.69050 |
| Index of Refraction | n20/D 1.562 |
| InChIKey | SHUUMGHTDLOJAU-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cccc(OC(C)C)c1-c1ccccc1Br |
| Storage condition | 2-8℃ |
|
~%
2-BROMO-2',6'-D... CAS#:870703-70-1 |
| Literature: Milne, Jacqueline E.; Buchwald, Stephen L. Journal of the American Chemical Society, 2004 , vol. 126, # 40 p. 13028 - 13032 |
|
~%
2-BROMO-2',6'-D... CAS#:870703-70-1 |
| Literature: Milne, Jacqueline E.; Buchwald, Stephen L. Journal of the American Chemical Society, 2004 , vol. 126, # 40 p. 13028 - 13032 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 2'-bromo-2,6-diisopropoxybiphenyl |
| 2'-bromo-2,6-bis(1-methylethoxy)biphenyl |
| 2-Bromo-2 inverted exclamation marka,6 inverted exclamation marka-diisopropoxybiphenyl |
| 2-Bromo-2',6'-diisopropoxy-1,1'-biphenyl |
| 2-Bromo-2 inverted exclamation marka,6 inverted exclamation marka-diisopropoxy-1,1 inverted exclamation marka-biphenyl |