2,6-Difluoro-4-formylphenylboronic acid pinacol ester structure
|
Common Name | 2,6-Difluoro-4-formylphenylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 870717-92-3 | Molecular Weight | 268.06400 | |
| Density | 1.17g/cm3 | Boiling Point | 334.8ºC at 760 mmHg | |
| Molecular Formula | C13H15BF2O3 | Melting Point | 135-139ºC | |
| MSDS | Chinese USA | Flash Point | 156.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,5-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 334.8ºC at 760 mmHg |
| Melting Point | 135-139ºC |
| Molecular Formula | C13H15BF2O3 |
| Molecular Weight | 268.06400 |
| Flash Point | 156.3ºC |
| Exact Mass | 268.10800 |
| PSA | 35.53000 |
| LogP | 2.07650 |
| Index of Refraction | 1.479 |
| InChIKey | KWYZDHWDFMOVOR-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2c(F)cc(C=O)cc2F)OC1(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,5-DICHLOROTHIOPHENOL |
| 2,6-difluoro-4-formylphenylboronic acid pinacol ester |