[3-(Benzyloxy)-2,6-difluorophenyl]boronic acid structure
|
Common Name | [3-(Benzyloxy)-2,6-difluorophenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 870718-07-3 | Molecular Weight | 264.032 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 439.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H11BF2O3 | Melting Point | 112-118ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 219.6±31.5 °C | |
| Name | 3-Benzyloxy-2,6-difluorophenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 439.6±55.0 °C at 760 mmHg |
| Melting Point | 112-118ºC(lit.) |
| Molecular Formula | C13H11BF2O3 |
| Molecular Weight | 264.032 |
| Flash Point | 219.6±31.5 °C |
| Exact Mass | 264.076935 |
| PSA | 49.69000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | MUKMMBLTLNKOAC-UHFFFAOYSA-N |
| SMILES | OB(O)c1c(F)ccc(OCc2ccccc2)c1F |
| Storage condition | 2~8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [3-(Benzyloxy)-2,6-difluorophenyl]boronic acid |
| Boronic acid, B-[2,6-difluoro-3-(phenylmethoxy)phenyl]- |
| (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid |