N-[(1R)-3-(Dimethylamino)-3-oxo-1-[(phenylthio)Methyl]propyl]carbamic Acid Phenylmethyl Ester structure
|
Common Name | N-[(1R)-3-(Dimethylamino)-3-oxo-1-[(phenylthio)Methyl]propyl]carbamic Acid Phenylmethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 870812-30-9 | Molecular Weight | 372.48100 | |
| Density | 1.2 | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl [(2R)-4-(dimethylamino)-4-oxo-1-(phenylsulfanyl)-2-butanyl ]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2 |
|---|---|
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.48100 |
| Exact Mass | 372.15100 |
| PSA | 87.43000 |
| LogP | 3.75640 |
| InChIKey | ZEGCMFVLMOXSFW-QGZVFWFLSA-N |
| SMILES | CN(C)C(=O)CC(CSc1ccccc1)NC(=O)OCc1ccccc1 |
|
~97%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: Elmore, Steven W.; Bruncko, Milan; Park, Cheol-Min Patent: US2005/272744 A1, 2005 ; Location in patent: Page/Page column 11-12 ; US 20050272744 A1 |
|
~85%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: Eswaran, Sumesh; Adhikari, Airody Vasudeva; Pal, Nishith K.; Chowdhury, Imran H. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 3 p. 1040 - 1044 |
|
~47%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: GENENTECH, INC.; WALTER AND ELIZA HALL INSTITUTE OF MEDICAL RESEARCH Patent: WO2008/61208 A2, 2008 ; Location in patent: Page/Page column 34; 36 ; WO 2008/061208 A2 |
|
~%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: US2012/35134 A1, ; |
|
~%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: US2012/35134 A1, ; |
|
~%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: US2012/35134 A1, ; |
|
~%
N-[(1R)-3-(Dime... CAS#:870812-30-9 |
| Literature: US2012/35134 A1, ; |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| Carbamic acid,(1-cyclohexyl-3-butenyl)-,phenylmethyl ester |
| benzyl {(1R)-3-(dimethylamino)-3-oxo-1-[(phenylthio)methyl]propyl}carbamate |
| benzyl (1R)-3-(dimethylamino)-3-oxo-1-((phenylsulfanyl)methyl)propylcarbamate |
| benzyl 1-cyclohexylbut-3-enylcarbamate |
| (R)-benzyl 4-(dimethylamino)-4-oxo-1-(phenylthio)butan-2-ylcarbamate |
| N-Benzyloxycarbonyl-1-cyclohexylbut-3-enylamine |
| benzyl (1-cyclohexylbut-3-en-1-yl)carbamate |