(R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate structure
|
Common Name | (R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 118399-28-3 | Molecular Weight | 235.236 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 466.1±44.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | 105.0 to 109.0 °C | |
| MSDS | N/A | Flash Point | 235.7±28.4 °C | |
| Name | Benzyl (R)-5-oxotetrahydrofuran-3-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.1±44.0 °C at 760 mmHg |
| Melting Point | 105.0 to 109.0 °C |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.236 |
| Flash Point | 235.7±28.4 °C |
| Exact Mass | 235.084457 |
| PSA | 64.63000 |
| LogP | 0.59 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | BNIBNUOPVTZWRT-SNVBAGLBSA-N |
| SMILES | O=C1CC(NC(=O)OCc2ccccc2)CO1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 24/25 |
| HS Code | 2932190090 |
|
~85%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: WO2009/36051 A1, ; Page/Page column 48 ; WO 2009/036051 A1 |
|
~85%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: US2012/35134 A1, ; Page/Page column 9; 32 ; |
|
~97%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: European Journal of Organic Chemistry, , # 29 p. 5705 - 5713 |
|
~76%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 7 p. 923 - 926 |
|
~%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: Journal of Organic Chemistry, , vol. 59, # 9 p. 2349 - 2357 |
|
~%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 7 p. 923 - 926 |
|
~%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: Journal of the American Chemical Society, , vol. 110, # 25 p. 8557 - 8558 |
|
~%
(R)-Benzyl (5-o... CAS#:118399-28-3 |
| Literature: Chemistry Letters, , # 5 p. 793 - 794 |
| Precursor 7 | |
|---|---|
| DownStream 5 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzyl [(3S)-5-oxotetrahydro-3-furanyl]carbamate |
| Benzyl (R)-Tetrahydro-5-oxo-3-furanylcarbamate |
| Carbamic acid, N-[(3R)-tetrahydro-5-oxo-3-furanyl]-, phenylmethyl ester |
| (R)-β-(Cbz-amino)-γ-butyrolactone |
| (R)-β-(Carbobenzoxyamino)-γ-butyrolactone |
| Benzyl [(3S)-5-oxotetrahydrofuran-3-yl]carbamate |
| (R)-3-(Cbz-Amino)-5-oxotetrahydrofuran |
| Carbamic acid, N-[(3S)-tetrahydro-5-oxo-3-furanyl]-, phenylmethyl ester |
| (R)-4-(Cbz-amino)tetrahydrofuran-2-one |
| (R)-Benzyl (5-oxotetrahydrofuran-3-yl)carbamate |
| Benzyl [(3R)-5-oxotetrahydro-3-furanyl]carbamate |
| (R)-4-(Carbobenzoxyamino)tetrahydrofuran-2-one |
| Cbz-R-3-Amino-γ-butyrolactone |
| Benzyl [(3R)-5-oxotetrahydrofuran-3-yl]carbamate |
| benzyl N-[(3R)-5-oxooxolan-3-yl]carbamate |