(1R,2R)-1,2-Bis(2-hydroxyphenyl)ethylenediamine structure
|
Common Name | (1R,2R)-1,2-Bis(2-hydroxyphenyl)ethylenediamine | ||
|---|---|---|---|---|
| CAS Number | 870991-70-1 | Molecular Weight | 244.28900 | |
| Density | 1.294g/cm3 | Boiling Point | 457.9ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2 | Melting Point | 157-163ºC | |
| MSDS | Chinese USA | Flash Point | 230.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[(1R,2R)-1,2-diamino-2-(2-hydroxyphenyl)ethyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 457.9ºC at 760 mmHg |
| Melting Point | 157-163ºC |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Flash Point | 230.7ºC |
| Exact Mass | 244.12100 |
| PSA | 92.50000 |
| LogP | 3.19820 |
| Index of Refraction | 1.677 |
| InChIKey | MRNPLGLZBUDMRE-ZIAGYGMSSA-N |
| SMILES | NC(c1ccccc1O)C(N)c1ccccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| MFCD09751760 |