(2,4,6-Trifluoro-3-propoxyphenyl)boronic acid structure
|
Common Name | (2,4,6-Trifluoro-3-propoxyphenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 871125-70-1 | Molecular Weight | 233.98000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10BF3O3 | Melting Point | 123-126ºC | |
| MSDS | USA | Flash Point | N/A | |
| Name | (2,4,6-Trifluoro-3-propoxyphenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 123-126ºC |
|---|---|
| Molecular Formula | C9H10BF3O3 |
| Molecular Weight | 233.98000 |
| Exact Mass | 234.06800 |
| PSA | 49.69000 |
| LogP | 0.57250 |
| InChIKey | FRGFAHSCPSYBHI-UHFFFAOYSA-N |
| SMILES | CCCOc1c(F)cc(F)c(B(O)O)c1F |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3-Propoxy-2,4,6-trifluorophenylboronic acid |
| PC1924 |