2,4,6-trifluoro-3-methoxybenzoic acid structure
|
Common Name | 2,4,6-trifluoro-3-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 886499-94-1 | Molecular Weight | 206.11900 | |
| Density | 1.487g/cm3 | Boiling Point | 291ºC at 760 mmHg | |
| Molecular Formula | C8H5F3O3 | Melting Point | 129.8ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-trifluoro-3-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.487g/cm3 |
|---|---|
| Boiling Point | 291ºC at 760 mmHg |
| Melting Point | 129.8ºC |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.11900 |
| Exact Mass | 206.01900 |
| PSA | 46.53000 |
| LogP | 1.81070 |
| InChIKey | HBJGDRQQDGUBGN-UHFFFAOYSA-N |
| SMILES | COc1c(F)cc(F)c(C(=O)O)c1F |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| JRD-1796 |
| 3-Methoxy-2,4,6-trifluorobenzoic acid |