haloxyfop-etotyl structure
|
Common Name | haloxyfop-etotyl | ||
|---|---|---|---|---|
| CAS Number | 87237-48-7 | Molecular Weight | 433.806 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 463.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H19ClF3NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 234.1±28.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | haloxyfop-etotyl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.4±45.0 °C at 760 mmHg |
| Molecular Formula | C19H19ClF3NO5 |
| Molecular Weight | 433.806 |
| Flash Point | 234.1±28.7 °C |
| Exact Mass | 433.090393 |
| PSA | 66.88000 |
| LogP | 3.14 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | MIJLZGZLQLAQCM-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | 22-36-60-61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | UA2458260 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
|
Name: qHTS for Inhibitors of binding or entry into cells for Marburg Virus
Source: NCGC
Target: gene 4 small orf - Marburg virus
External Id: VSVM-OFFLINE
|
|
Name: qHTS for Inhibitors of binding or entry into cells for Lassa Virus
Source: NCGC
Target: N/A
External Id: VSVL-OFFLINE
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| T6NJ BOR DOY1&VO2O2& CG EXFFF |
| Haloxyfop ethoxyethyl ester |
| Gallant 125EE |
| rac-2-ethoxyethyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| Zellek |
| Gallant |
| MFCD00144430 |
| 2-Ethoxyethyl 2-(4-{[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoate |
| 2-Ethoxyethyl 2-[4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
| 2-ethoxyethyl (RS)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionate |
| haloxyfop-etotyl |
| Dowco 453EE |
| EINECS 402-560-5 |
| 2-Ethoxyethyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| 2-Ethoxyethyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| 2-ethoxyethyl 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoate |
| Propanoic acid, 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, 2-ethoxyethyl ester |
| Haloxyfop-ethoxyethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of haloxyfop-etotyl? |
| A: Molecular weight of haloxyfop-etotyl is 433.806. |
| Q: What is the polar surface area (PSA) of haloxyfop-etotyl? |
| A: Polar surface area (PSA) of haloxyfop-etotyl is 66.88000. |
| Q: What is the molecular formula of haloxyfop-etotyl? |
| A: Molecular formula of haloxyfop-etotyl is C19H19ClF3NO5. |
| Q: What is the safety information for haloxyfop-etotyl? |
| A: Safety information for haloxyfop-etotyl: 22-36-60-61. |
| Q: What is the InChIKey of haloxyfop-etotyl? |
| A: InChIKey of haloxyfop-etotyl is MIJLZGZLQLAQCM-UHFFFAOYSA-N. |
| Q: What is the CAS number of haloxyfop-etotyl? |
| A: CAS number of haloxyfop-etotyl is 87237-48-7. |
| Q: What is the English name of haloxyfop-etotyl? |
| A: The English name of haloxyfop-etotyl is haloxyfop-etotyl. |
| Q: What is the LogP of haloxyfop-etotyl? |
| A: LogP of haloxyfop-etotyl is 3.14. |
| Q: What is the SMILES notation of haloxyfop-etotyl? |
| A: SMILES notation of haloxyfop-etotyl is CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1. |
| Q: What is the boiling point of haloxyfop-etotyl? |
| A: Boiling point of haloxyfop-etotyl is 463.4±45.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |