7-Bromo-5-nitro-1H-indole structure
|
Common Name | 7-Bromo-5-nitro-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 87240-07-1 | Molecular Weight | 241.042 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 402.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BrN2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 197.1±23.2 °C | |
| Name | 7-bromo-5-nitro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.3±25.0 °C at 760 mmHg |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.042 |
| Flash Point | 197.1±23.2 °C |
| Exact Mass | 239.953430 |
| PSA | 61.61000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.747 |
| InChIKey | XXJOZTUJVYCOMP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c2[nH]ccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~88%
7-Bromo-5-nitro... CAS#:87240-07-1 |
| Literature: Phytochemistry (Elsevier), , vol. 21, # 12 p. 2879 - 2886 |
|
~%
7-Bromo-5-nitro... CAS#:87240-07-1 |
| Literature: Phytochemistry (Elsevier), , vol. 21, # 12 p. 2879 - 2886 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-bromo-5-nitroindole |
| 7-Bromo-5-nitro-1H-indole |
| 1H-Indole, 7-bromo-5-nitro- |